C26H26N4O4S — CID 90869064
N,N-dimethyl-2-[N-methylsulfonyl-3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide (PubChem CID 90869064) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is N,N-dimethyl-2-[N-methylsulfonyl-3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide.
| Compound Name | N,N-dimethyl-2-[N-methylsulfonyl-3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide |
|---|---|
| PubChem CID | 90869064 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N,N-dimethyl-2-[N-methylsulfonyl-3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide |
| SMILES | CN(C)C(=O)CN(c1cccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccccc32)c1)S(C)(=O)=O |
| InChI | InChI=1S/C26H26N4O4S/c1-29(2)23(31)17-30(35(3,33)34)20-13-9-12-19(16-20)27-25(18-10-5-4-6-11-18)24-21-14-7-8-15-22(21)28-26(24)32/h4-16,24H,17H2,1-3H3,(H,28,32)/b27-25+ |
| InChIKey | PKXGOYVNENCQAN-IMVLJIQESA-N |
| XLogP | 3.40 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|