C28H26BrClN4O3 — CID 91482701
3-bromo-N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-N-[2-(dimethylamino)-2-oxoethyl]propanamide (PubChem CID 91482701) has the molecular formula C28H26BrClN4O3 and a molecular weight of 581.90 g/mol. Its IUPAC name is 3-bromo-N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-N-[2-(dimethylamino)-2-oxoethyl]propanamide.
| Compound Name | 3-bromo-N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-N-[2-(dimethylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 91482701 |
| Molecular Formula | C28H26BrClN4O3 |
| Molecular Weight | 581.90 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 3-bromo-N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-N-[2-(dimethylamino)-2-oxoethyl]propanamide |
| SMILES | CN(C)C(=O)CN(C(=O)CCBr)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C28H26BrClN4O3/c1-33(2)25(36)17-34(24(35)14-15-29)21-11-9-20(10-12-21)31-27(18-6-4-3-5-7-18)26-22-13-8-19(30)16-23(22)32-28(26)37/h3-13,16,26H,14-15,17H2,1-2H3,(H,32,37)/b31-27+ |
| InChIKey | NSPREYSBAOGDBX-TVKQRKNISA-N |
| XLogP | 5.40 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.90 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|