C26H27ClN6O2 — CID 91428906
N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-(3,4-diaminophenyl)methylidene]amino]phenyl]-2-(dimethylamino)-N-methylacetamide (PubChem CID 91428906) has the molecular formula C26H27ClN6O2 and a molecular weight of 491.00 g/mol. Its IUPAC name is N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-(3,4-diaminophenyl)methylidene]amino]phenyl]-2-(dimethylamino)-N-methylacetamide.
| Compound Name | N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-(3,4-diaminophenyl)methylidene]amino]phenyl]-2-(dimethylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 91428906 |
| Molecular Formula | C26H27ClN6O2 |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-(3,4-diaminophenyl)methylidene]amino]phenyl]-2-(dimethylamino)-N-methylacetamide |
| SMILES | CN(C)CC(=O)N(C)c1ccc(/N=C(\c2ccc(N)c(N)c2)C2C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C26H27ClN6O2/c1-32(2)14-23(34)33(3)18-8-6-17(7-9-18)30-25(15-4-11-20(28)21(29)12-15)24-19-10-5-16(27)13-22(19)31-26(24)35/h4-13,24H,14,28-29H2,1-3H3,(H,31,35)/b30-25+ |
| InChIKey | NGTPMHAMLJONAV-QCWLDUFUSA-N |
| XLogP | 3.89 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|