C27H27ClN6O4 — CID 91575576
N-[4-[[(4-amino-3-nitrophenyl)-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 91575576) has the molecular formula C27H27ClN6O4 and a molecular weight of 535.00 g/mol. Its IUPAC name is N-[4-[[(4-amino-3-nitrophenyl)-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | N-[4-[[(4-amino-3-nitrophenyl)-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 91575576 |
| Molecular Formula | C27H27ClN6O4 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-[4-[[(4-amino-3-nitrophenyl)-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CC(=O)N(CCN(C)C)c1ccc(/N=C(\c2ccc(N)c([N+](=O)[O-])c2)C2C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C27H27ClN6O4/c1-16(35)33(13-12-32(2)3)20-8-6-19(7-9-20)30-26(17-4-11-22(29)24(14-17)34(37)38)25-21-10-5-18(28)15-23(21)31-27(25)36/h4-11,14-15,25H,12-13,29H2,1-3H3,(H,31,36)/b30-26+ |
| InChIKey | YOFPRKNQFPGSNP-URGPHPNLSA-N |
| XLogP | 4.60 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|