C26H24ClN5O3 — CID 90769128
3-[C-(4-amino-3-nitrophenyl)-N-[4-(pyrrolidin-1-ylmethyl)phenyl]carbonimidoyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 90769128) has the molecular formula C26H24ClN5O3 and a molecular weight of 489.96 g/mol. Its IUPAC name is 3-[C-(4-amino-3-nitrophenyl)-N-[4-(pyrrolidin-1-ylmethyl)phenyl]carbonimidoyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 3-[C-(4-amino-3-nitrophenyl)-N-[4-(pyrrolidin-1-ylmethyl)phenyl]carbonimidoyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90769128 |
| Molecular Formula | C26H24ClN5O3 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 3-[C-(4-amino-3-nitrophenyl)-N-[4-(pyrrolidin-1-ylmethyl)phenyl]carbonimidoyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | Nc1ccc(/C(=N\c2ccc(CN3CCCC3)cc2)C2C(=O)Nc3cc(Cl)ccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H24ClN5O3/c27-18-6-9-20-22(14-18)30-26(33)24(20)25(17-5-10-21(28)23(13-17)32(34)35)29-19-7-3-16(4-8-19)15-31-11-1-2-12-31/h3-10,13-14,24H,1-2,11-12,15,28H2,(H,30,33)/b29-25+ |
| InChIKey | ATUGPZMCHVKINZ-XLVZBRSZSA-N |
| XLogP | 5.28 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|