C28H27N5O6 — CID 90725219
N-[4-[[1,3-benzodioxol-5-yl-(6-nitro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]-3-(dimethylamino)-N-methylpropanamide (PubChem CID 90725219) has the molecular formula C28H27N5O6 and a molecular weight of 529.55 g/mol. Its IUPAC name is N-[4-[[1,3-benzodioxol-5-yl-(6-nitro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]-3-(dimethylamino)-N-methylpropanamide.
| Compound Name | N-[4-[[1,3-benzodioxol-5-yl-(6-nitro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]-3-(dimethylamino)-N-methylpropanamide |
|---|---|
| PubChem CID | 90725219 |
| Molecular Formula | C28H27N5O6 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | N-[4-[[1,3-benzodioxol-5-yl-(6-nitro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]-3-(dimethylamino)-N-methylpropanamide |
| SMILES | CN(C)CCC(=O)N(C)c1ccc(/N=C(\c2ccc3c(c2)OCO3)C2C(=O)Nc3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C28H27N5O6/c1-31(2)13-12-25(34)32(3)19-7-5-18(6-8-19)29-27(17-4-11-23-24(14-17)39-16-38-23)26-21-10-9-20(33(36)37)15-22(21)30-28(26)35/h4-11,14-15,26H,12-13,16H2,1-3H3,(H,30,35)/b29-27+ |
| InChIKey | UMEPGWULLWTDCE-ORIPQNMZSA-N |
| XLogP | 4.09 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|