C32H35BrN4O4 — CID 91242371
3-[4-[C-(6-bromo-2-oxo-1,3-dihydroindol-3-yl)-N-[4-[5-(dimethylamino)pentanoyl-methylamino]phenyl]carbonimidoyl]phenyl]propanoic acid (PubChem CID 91242371) has the molecular formula C32H35BrN4O4 and a molecular weight of 619.56 g/mol. Its IUPAC name is 3-[4-[C-(6-bromo-2-oxo-1,3-dihydroindol-3-yl)-N-[4-[5-(dimethylamino)pentanoyl-methylamino]phenyl]carbonimidoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[C-(6-bromo-2-oxo-1,3-dihydroindol-3-yl)-N-[4-[5-(dimethylamino)pentanoyl-methylamino]phenyl]carbonimidoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91242371 |
| Molecular Formula | C32H35BrN4O4 |
| Molecular Weight | 619.56 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | 3-[4-[C-(6-bromo-2-oxo-1,3-dihydroindol-3-yl)-N-[4-[5-(dimethylamino)pentanoyl-methylamino]phenyl]carbonimidoyl]phenyl]propanoic acid |
| SMILES | CN(C)CCCCC(=O)N(C)c1ccc(/N=C(\c2ccc(CCC(=O)O)cc2)C2C(=O)Nc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C32H35BrN4O4/c1-36(2)19-5-4-6-28(38)37(3)25-15-13-24(14-16-25)34-31(22-10-7-21(8-11-22)9-18-29(39)40)30-26-17-12-23(33)20-27(26)35-32(30)41/h7-8,10-17,20,30H,4-6,9,18-19H2,1-3H3,(H,35,41)(H,39,40)/b34-31+ |
| InChIKey | TZJVDRWPWIJPBG-WUVHBKSUSA-N |
| XLogP | 6.02 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|