C31H33ClN4O4 — CID 90808358
2-[4-[C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-N-[4-[5-(dimethylamino)pentanoyl-methylamino]phenyl]carbonimidoyl]phenyl]acetic acid (PubChem CID 90808358) has the molecular formula C31H33ClN4O4 and a molecular weight of 561.08 g/mol. Its IUPAC name is 2-[4-[C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-N-[4-[5-(dimethylamino)pentanoyl-methylamino]phenyl]carbonimidoyl]phenyl]acetic acid.
| Compound Name | 2-[4-[C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-N-[4-[5-(dimethylamino)pentanoyl-methylamino]phenyl]carbonimidoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 90808358 |
| Molecular Formula | C31H33ClN4O4 |
| Molecular Weight | 561.08 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 2-[4-[C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-N-[4-[5-(dimethylamino)pentanoyl-methylamino]phenyl]carbonimidoyl]phenyl]acetic acid |
| SMILES | CN(C)CCCCC(=O)N(C)c1ccc(/N=C(\c2ccc(CC(=O)O)cc2)C2C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C31H33ClN4O4/c1-35(2)17-5-4-6-27(37)36(3)24-14-12-23(13-15-24)33-30(21-9-7-20(8-10-21)18-28(38)39)29-25-16-11-22(32)19-26(25)34-31(29)40/h7-16,19,29H,4-6,17-18H2,1-3H3,(H,34,40)(H,38,39)/b33-30+ |
| InChIKey | DAWVIUHHAJNJIQ-KKYHWDRJSA-N |
| XLogP | 5.52 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.08 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|