C30H31ClN4O4 — CID 91214429
3-[4-[N-[4-[acetyl-[3-(methylamino)propyl]amino]phenyl]-C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)carbonimidoyl]phenyl]propanoic acid (PubChem CID 91214429) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is 3-[4-[N-[4-[acetyl-[3-(methylamino)propyl]amino]phenyl]-C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)carbonimidoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[N-[4-[acetyl-[3-(methylamino)propyl]amino]phenyl]-C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)carbonimidoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91214429 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 3-[4-[N-[4-[acetyl-[3-(methylamino)propyl]amino]phenyl]-C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)carbonimidoyl]phenyl]propanoic acid |
| SMILES | CNCCCN(C(C)=O)c1ccc(/N=C(\c2ccc(CCC(=O)O)cc2)C2C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C30H31ClN4O4/c1-19(36)35(17-3-16-32-2)24-12-10-23(11-13-24)33-29(21-7-4-20(5-8-21)6-15-27(37)38)28-25-14-9-22(31)18-26(25)34-30(28)39/h4-5,7-14,18,28,32H,3,6,15-17H2,1-2H3,(H,34,39)(H,37,38)/b33-29+ |
| InChIKey | MRVYHSIQDZSORX-XPXRSFDGSA-N |
| XLogP | 5.18 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|