C25H23ClN4O2 — CID 91315699
N-(2-aminoethyl)-N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]acetamide (PubChem CID 91315699) has the molecular formula C25H23ClN4O2 and a molecular weight of 446.94 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]acetamide.
| Compound Name | N-(2-aminoethyl)-N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 91315699 |
| Molecular Formula | C25H23ClN4O2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-(2-aminoethyl)-N-[4-[[(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]acetamide |
| SMILES | CC(=O)N(CCN)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C25H23ClN4O2/c1-16(31)30(14-13-27)20-10-8-19(9-11-20)28-24(17-5-3-2-4-6-17)23-21-12-7-18(26)15-22(21)29-25(23)32/h2-12,15,23H,13-14,27H2,1H3,(H,29,32)/b28-24+ |
| InChIKey | DHHWPHCHHJVZFP-ZZIIXHQDSA-N |
| XLogP | 4.51 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|