C31H35N3O3 — CID 90940071
methyl 3-[N-[4-[[hexyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate (PubChem CID 90940071) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is methyl 3-[N-[4-[[hexyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 3-[N-[4-[[hexyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 90940071 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | methyl 3-[N-[4-[[hexyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
| SMILES | CCCCCCN(C)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(C(=O)OC)ccc32)cc1 |
| InChI | InChI=1S/C31H35N3O3/c1-4-5-6-10-19-34(2)21-22-13-16-25(17-14-22)32-29(23-11-8-7-9-12-23)28-26-18-15-24(31(36)37-3)20-27(26)33-30(28)35/h7-9,11-18,20,28H,4-6,10,19,21H2,1-3H3,(H,33,35)/b32-29+ |
| InChIKey | JLPGZGQSEXPQJI-UUDCSCGESA-N |
| XLogP | 6.34 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|