C31H37N3O3 — CID 91584106
5,6-diethoxy-3-[N-[4-[[ethyl(propyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 91584106) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 5,6-diethoxy-3-[N-[4-[[ethyl(propyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5,6-diethoxy-3-[N-[4-[[ethyl(propyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91584106 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 5,6-diethoxy-3-[N-[4-[[ethyl(propyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | CCCN(CC)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(OCC)c(OCC)cc32)cc1 |
| InChI | InChI=1S/C31H37N3O3/c1-5-18-34(6-2)21-22-14-16-24(17-15-22)32-30(23-12-10-9-11-13-23)29-25-19-27(36-7-3)28(37-8-4)20-26(25)33-31(29)35/h9-17,19-20,29H,5-8,18,21H2,1-4H3,(H,33,35)/b32-30+ |
| InChIKey | RPCHKQHWZYLAGS-NHQGMKOOSA-N |
| XLogP | 6.57 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|