C26H24N2O5 — CID 91002498
4-[[(5,6-diethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoic acid (PubChem CID 91002498) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-[[(5,6-diethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoic acid.
| Compound Name | 4-[[(5,6-diethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 91002498 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 4-[[(5,6-diethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoic acid |
| SMILES | CCOc1cc2c(cc1OCC)C(/C(=N/c1ccc(C(=O)O)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C26H24N2O5/c1-3-32-21-14-19-20(15-22(21)33-4-2)28-25(29)23(19)24(16-8-6-5-7-9-16)27-18-12-10-17(11-13-18)26(30)31/h5-15,23H,3-4H2,1-2H3,(H,28,29)(H,30,31)/b27-24+ |
| InChIKey | FSGMYDGRUYBEDP-SOYKGTTHSA-N |
| XLogP | 5.04 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|