C31H37N3O3 — CID 91464284
3-[N-[4-[2-(diethylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-5,6-diethoxy-1,3-dihydroindol-2-one (PubChem CID 91464284) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 3-[N-[4-[2-(diethylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-5,6-diethoxy-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-[2-(diethylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-5,6-diethoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91464284 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 3-[N-[4-[2-(diethylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-5,6-diethoxy-1,3-dihydroindol-2-one |
| SMILES | CCOc1cc2c(cc1OCC)C(/C(=N/c1ccc(CCN(CC)CC)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C31H37N3O3/c1-5-34(6-2)19-18-22-14-16-24(17-15-22)32-30(23-12-10-9-11-13-23)29-25-20-27(36-7-3)28(37-8-4)21-26(25)33-31(29)35/h9-17,20-21,29H,5-8,18-19H2,1-4H3,(H,33,35)/b32-30+ |
| InChIKey | RRAFISLKBVWISZ-NHQGMKOOSA-N |
| XLogP | 6.22 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|