C29H33N3O3 — CID 91603378
5,6-diethoxy-3-[C-phenyl-N-[4-(propylaminomethyl)phenyl]carbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 91603378) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 5,6-diethoxy-3-[C-phenyl-N-[4-(propylaminomethyl)phenyl]carbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5,6-diethoxy-3-[C-phenyl-N-[4-(propylaminomethyl)phenyl]carbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91603378 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 5,6-diethoxy-3-[C-phenyl-N-[4-(propylaminomethyl)phenyl]carbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | CCCNCc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(OCC)c(OCC)cc32)cc1 |
| InChI | InChI=1S/C29H33N3O3/c1-4-16-30-19-20-12-14-22(15-13-20)31-28(21-10-8-7-9-11-21)27-23-17-25(34-5-2)26(35-6-3)18-24(23)32-29(27)33/h7-15,17-18,27,30H,4-6,16,19H2,1-3H3,(H,32,33)/b31-28+ |
| InChIKey | NTQZMZOBVOPQNI-CCFHIKDMSA-N |
| XLogP | 5.84 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|