C25H23N3O2 — CID 57063988
3-(C,N-diphenylcarbonimidoyl)-2-oxo-N-propyl-1,3-dihydroindole-5-carboxamide (PubChem CID 57063988) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-(C,N-diphenylcarbonimidoyl)-2-oxo-N-propyl-1,3-dihydroindole-5-carboxamide.
| Compound Name | 3-(C,N-diphenylcarbonimidoyl)-2-oxo-N-propyl-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 57063988 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-(C,N-diphenylcarbonimidoyl)-2-oxo-N-propyl-1,3-dihydroindole-5-carboxamide |
| SMILES | CCCNC(=O)c1ccc2c(c1)C(/C(=N/c1ccccc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C25H23N3O2/c1-2-15-26-24(29)18-13-14-21-20(16-18)22(25(30)28-21)23(17-9-5-3-6-10-17)27-19-11-7-4-8-12-19/h3-14,16,22H,2,15H2,1H3,(H,26,29)(H,28,30)/b27-23+ |
| InChIKey | PKYVVTYGIHEXCS-SLEBQGDGSA-N |
| XLogP | 4.68 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|