C30H32N4O5 — CID 91500670
[3-[N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl] methyl carbonate (PubChem CID 91500670) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is [3-[N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl] methyl carbonate.
| Compound Name | [3-[N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl] methyl carbonate |
|---|---|
| PubChem CID | 91500670 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | [3-[N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl] methyl carbonate |
| SMILES | CCN(CC)CCNC(=O)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(OC(=O)OC)ccc32)cc1 |
| InChI | InChI=1S/C30H32N4O5/c1-4-34(5-2)18-17-31-28(35)21-11-13-22(14-12-21)32-27(20-9-7-6-8-10-20)26-24-16-15-23(39-30(37)38-3)19-25(24)33-29(26)36/h6-16,19,26H,4-5,17-18H2,1-3H3,(H,31,35)(H,33,36)/b32-27+ |
| InChIKey | HYJNXPBYGYRHBY-QVAGMWBUSA-N |
| XLogP | 4.76 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|