C29H29N3O3S — CID 90784307
ethyl 2-oxo-3-[C-phenyl-N-[4-(thiomorpholin-4-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-6-carboxylate (PubChem CID 90784307) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is ethyl 2-oxo-3-[C-phenyl-N-[4-(thiomorpholin-4-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-6-carboxylate.
| Compound Name | ethyl 2-oxo-3-[C-phenyl-N-[4-(thiomorpholin-4-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 90784307 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | ethyl 2-oxo-3-[C-phenyl-N-[4-(thiomorpholin-4-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(CN2CCSCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O3S/c1-2-35-29(34)22-10-13-24-25(18-22)31-28(33)26(24)27(21-6-4-3-5-7-21)30-23-11-8-20(9-12-23)19-32-14-16-36-17-15-32/h3-13,18,26H,2,14-17,19H2,1H3,(H,31,33)/b30-27+ |
| InChIKey | SGZYOACDRDJGTN-KDJFERLWSA-N |
| XLogP | 5.27 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|