C28H22N4O5 — CID 91536110
ethyl 3-[N-[4-[(2,5-dioxoimidazolidin-4-ylidene)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate (PubChem CID 91536110) has the molecular formula C28H22N4O5 and a molecular weight of 494.51 g/mol. Its IUPAC name is ethyl 3-[N-[4-[(2,5-dioxoimidazolidin-4-ylidene)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate.
| Compound Name | ethyl 3-[N-[4-[(2,5-dioxoimidazolidin-4-ylidene)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 91536110 |
| Molecular Formula | C28H22N4O5 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | ethyl 3-[N-[4-[(2,5-dioxoimidazolidin-4-ylidene)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(C=C2NC(=O)NC2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N4O5/c1-2-37-27(35)18-10-13-20-21(15-18)30-26(34)23(20)24(17-6-4-3-5-7-17)29-19-11-8-16(9-12-19)14-22-25(33)32-28(36)31-22/h3-15,23H,2H2,1H3,(H,30,34)(H2,31,32,33,36)/b22-14?,29-24+ |
| InChIKey | CVHCBYFRNAIKKK-VHFKZQDCSA-N |
| XLogP | 3.90 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|