C28H26N4O4 — CID 91168794
methyl 2-oxo-3-[N-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindole-6-carboxylate (PubChem CID 91168794) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is methyl 2-oxo-3-[N-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 2-oxo-3-[N-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 91168794 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | methyl 2-oxo-3-[N-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(CN2CCNC(=O)C2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N4O4/c1-36-28(35)20-9-12-22-23(15-20)31-27(34)25(22)26(19-5-3-2-4-6-19)30-21-10-7-18(8-11-21)16-32-14-13-29-24(33)17-32/h2-12,15,25H,13-14,16-17H2,1H3,(H,29,33)(H,31,34)/b30-26+ |
| InChIKey | SDPGONNAZVDTAG-URGPHPNLSA-N |
| XLogP | 3.26 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|