methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate

C14H19NO2 — CID 86099354

IUPACmethyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate
SMILESCCCC1CCc2ccc(C(=O)OC)cc2N1
InChIInChI=1S/C14H19NO2/c1-3-4-12-8-7-10-5-6-11(14(16)17-2)9-13(10)15-12/h5-6,9,12,15H,3-4,7-8H2,1-2H3
InChIKeyCALZDRZMYOVHRL-UHFFFAOYSA-N
MW233.31 g/mol
LogP3.00
Rot. Bonds3

About methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate

methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate (PubChem CID 86099354) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate.

Molecular Properties

Compound Namemethyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate
PubChem CID86099354
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Namemethyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate
SMILESCCCC1CCc2ccc(C(=O)OC)cc2N1
InChIInChI=1S/C14H19NO2/c1-3-4-12-8-7-10-5-6-11(14(16)17-2)9-13(10)15-12/h5-6,9,12,15H,3-4,7-8H2,1-2H3
InChIKeyCALZDRZMYOVHRL-UHFFFAOYSA-N
XLogP3.00
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 53.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate?
The IUPAC name of methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate (CID 86099354) is methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate.
What is the SMILES notation for methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate?
The canonical SMILES for methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate is CCCC1CCc2ccc(C(=O)OC)cc2N1.
What is the InChIKey of methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate?
The InChIKey is CALZDRZMYOVHRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-3-4-12-8-7-10-5-6-11(14(16)17-2)9-13(10)15-12/h5-6,9,12,15H,3-4,7-8H2,1-2H3.
What are the key properties of methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate?
methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate has a molecular weight of 233.31 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-propyl-1,2,3,4-tetrahydroquinoline-7-carboxylate is sourced from PubChem (CID 86099354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).