C10H12N2O2S — CID 141413895
methyl 2-sulfanyl-1,2,3,4-tetrahydroquinazoline-7-carboxylate (PubChem CID 141413895) has the molecular formula C10H12N2O2S and a molecular weight of 224.29 g/mol. Its IUPAC name is methyl 2-sulfanyl-1,2,3,4-tetrahydroquinazoline-7-carboxylate.
| Compound Name | methyl 2-sulfanyl-1,2,3,4-tetrahydroquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 141413895 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | methyl 2-sulfanyl-1,2,3,4-tetrahydroquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(S)NC2 |
| InChI | InChI=1S/C10H12N2O2S/c1-14-9(13)6-2-3-7-5-11-10(15)12-8(7)4-6/h2-4,10-12,15H,5H2,1H3 |
| InChIKey | HDTNHZGDQQLHSB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|