C21H18N2O6 — CID 122207365
dimethyl 2,2'-dioxo-3,3'-spirobi[1,4-dihydroquinoline]-6',7-dicarboxylate (PubChem CID 122207365) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is dimethyl 2,2'-dioxo-3,3'-spirobi[1,4-dihydroquinoline]-6',7-dicarboxylate.
| Compound Name | dimethyl 2,2'-dioxo-3,3'-spirobi[1,4-dihydroquinoline]-6',7-dicarboxylate |
|---|---|
| PubChem CID | 122207365 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | dimethyl 2,2'-dioxo-3,3'-spirobi[1,4-dihydroquinoline]-6',7-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC1(Cc3ccc(C(=O)OC)cc3NC1=O)C(=O)N2 |
| InChI | InChI=1S/C21H18N2O6/c1-28-17(24)11-5-6-15-14(7-11)10-21(19(26)22-15)9-13-4-3-12(18(25)29-2)8-16(13)23-20(21)27/h3-8H,9-10H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | FHWKJIYQYWAIIR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|