C11H13NO3 — CID 91608162
methyl 2-methoxy-2,3-dihydro-1H-indole-6-carboxylate (PubChem CID 91608162) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 2-methoxy-2,3-dihydro-1H-indole-6-carboxylate.
| Compound Name | methyl 2-methoxy-2,3-dihydro-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 91608162 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | methyl 2-methoxy-2,3-dihydro-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(OC)C2 |
| InChI | InChI=1S/C11H13NO3/c1-14-10-6-7-3-4-8(11(13)15-2)5-9(7)12-10/h3-5,10,12H,6H2,1-2H3 |
| InChIKey | BUEQXNFHHDIVAK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |