C19H28N2O2 — CID 90916506
methyl (1R,10S,13R)-13-amino-13-(propylaminomethyl)tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate (PubChem CID 90916506) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is methyl (1R,10S,13R)-13-amino-13-(propylaminomethyl)tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate.
| Compound Name | methyl (1R,10S,13R)-13-amino-13-(propylaminomethyl)tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate |
|---|---|
| PubChem CID | 90916506 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | methyl (1R,10S,13R)-13-amino-13-(propylaminomethyl)tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate |
| SMILES | CCCNC[C@]1(N)[C@@H]2CC[C@H]1Cc1ccc(C(=O)OC)cc1C2 |
| InChI | InChI=1S/C19H28N2O2/c1-3-8-21-12-19(20)16-6-7-17(19)11-15-9-14(18(22)23-2)5-4-13(15)10-16/h4-5,9,16-17,21H,3,6-8,10-12,20H2,1-2H3/t16-,17+,19+/m0/s1 |
| InChIKey | MIOUGVBNABRPBR-YQVWRLOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|