C18H23F3N2O2 — CID 58631466
methyl (1S,10R,13R)-13-amino-13-[(2,2,2-trifluoroethylamino)methyl]tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate (PubChem CID 58631466) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is methyl (1S,10R,13R)-13-amino-13-[(2,2,2-trifluoroethylamino)methyl]tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate.
| Compound Name | methyl (1S,10R,13R)-13-amino-13-[(2,2,2-trifluoroethylamino)methyl]tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate |
|---|---|
| PubChem CID | 58631466 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl (1S,10R,13R)-13-amino-13-[(2,2,2-trifluoroethylamino)methyl]tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C[C@@H]1CC[C@H](C2)[C@]1(N)CNCC(F)(F)F |
| InChI | InChI=1S/C18H23F3N2O2/c1-25-16(24)12-3-2-11-7-14-4-5-15(8-13(11)6-12)17(14,22)9-23-10-18(19,20)21/h2-3,6,14-15,23H,4-5,7-10,22H2,1H3/t14-,15+,17-/m1/s1 |
| InChIKey | OHZUPWHFFUBPCP-HLLBOEOZSA-N |
| XLogP | 2.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |