C21H25F3N2O5S — CID 71121156
ethyl 3-[(1'R,4R,10'S)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl]-3-oxopropanoate (PubChem CID 71121156) has the molecular formula C21H25F3N2O5S and a molecular weight of 474.50 g/mol. Its IUPAC name is ethyl 3-[(1'R,4R,10'S)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[(1'R,4R,10'S)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 71121156 |
| Molecular Formula | C21H25F3N2O5S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | ethyl 3-[(1'R,4R,10'S)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1ccc2c(c1)C[C@H]1CC[C@@H](C2)[C@]12CN(CC(F)(F)F)S(=O)(=O)N2 |
| InChI | InChI=1S/C21H25F3N2O5S/c1-2-31-19(28)10-18(27)14-4-3-13-8-16-5-6-17(9-15(13)7-14)20(16)11-26(12-21(22,23)24)32(29,30)25-20/h3-4,7,16-17,25H,2,5-6,8-12H2,1H3/t16-,17+,20+/m0/s1 |
| InChIKey | ULTBCWIYJNLWFE-SQGPQFPESA-N |
| XLogP | 2.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|