C26H32N2O3S — CID 58742057
(1'S,4R,10'R)-2-(cyclobutylmethyl)-5'-phenylmethoxyspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 58742057) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is (1'S,4R,10'R)-2-(cyclobutylmethyl)-5'-phenylmethoxyspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | (1'S,4R,10'R)-2-(cyclobutylmethyl)-5'-phenylmethoxyspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 58742057 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (1'S,4R,10'R)-2-(cyclobutylmethyl)-5'-phenylmethoxyspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | O=S1(=O)N[C@]2(CN1CC1CCC1)[C@@H]1CC[C@H]2Cc2cc(OCc3ccccc3)ccc2C1 |
| InChI | InChI=1S/C26H32N2O3S/c29-32(30)27-26(18-28(32)16-19-7-4-8-19)23-10-11-24(26)14-22-15-25(12-9-21(22)13-23)31-17-20-5-2-1-3-6-20/h1-3,5-6,9,12,15,19,23-24,27H,4,7-8,10-11,13-14,16-18H2/t23-,24+,26-/m1/s1 |
| InChIKey | KODMQPNVAYQFCR-RMTZWNOUSA-N |
| XLogP | 4.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |