C25H32N2O3S — CID 10275024
5'-phenylmethoxy-2-propylspiro[1,2,6-thiadiazinane-5,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 10275024) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is 5'-phenylmethoxy-2-propylspiro[1,2,6-thiadiazinane-5,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | 5'-phenylmethoxy-2-propylspiro[1,2,6-thiadiazinane-5,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 10275024 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 5'-phenylmethoxy-2-propylspiro[1,2,6-thiadiazinane-5,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | CCCN1CCC2(NS1(=O)=O)C1CCC2Cc2cc(OCc3ccccc3)ccc2C1 |
| InChI | InChI=1S/C25H32N2O3S/c1-2-13-27-14-12-25(26-31(27,28)29)22-9-10-23(25)16-21-17-24(11-8-20(21)15-22)30-18-19-6-4-3-5-7-19/h3-8,11,17,22-23,26H,2,9-10,12-16,18H2,1H3 |
| InChIKey | NVWJNDUGEDMENC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |