C23H25NO3S — CID 163900007
(3R,10'S)-5'-phenylmethoxyspiro[2,4-dihydrothiazine-3,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 163900007) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is (3R,10'S)-5'-phenylmethoxyspiro[2,4-dihydrothiazine-3,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | (3R,10'S)-5'-phenylmethoxyspiro[2,4-dihydrothiazine-3,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 163900007 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (3R,10'S)-5'-phenylmethoxyspiro[2,4-dihydrothiazine-3,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | O=S1(=O)C=CC[C@]2(N1)C1CC[C@H]2Cc2ccc(OCc3ccccc3)cc2C1 |
| InChI | InChI=1S/C23H25NO3S/c25-28(26)12-4-11-23(24-28)20-8-9-21(23)14-19-15-22(10-7-18(19)13-20)27-16-17-5-2-1-3-6-17/h1-7,10,12,15,20-21,24H,8-9,11,13-14,16H2/t20-,21?,23+/m0/s1 |
| InChIKey | QIZDWGQTUYRIEU-AXUWQRLWSA-N |
| XLogP | 3.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |