C17H19NO2 — CID 91072000
ethane;6-phenylmethoxy-2,3-dihydroisoindol-1-one (PubChem CID 91072000) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethane;6-phenylmethoxy-2,3-dihydroisoindol-1-one.
| Compound Name | ethane;6-phenylmethoxy-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 91072000 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethane;6-phenylmethoxy-2,3-dihydroisoindol-1-one |
| SMILES | CC.O=C1NCc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C15H13NO2.C2H6/c17-15-14-8-13(7-6-12(14)9-16-15)18-10-11-4-2-1-3-5-11;1-2/h1-8H,9-10H2,(H,16,17);1-2H3 |
| InChIKey | HEADJFRKXQBARL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |