C24H27F3N2O3S — CID 71016793
(1'R,4R,10'S)-5'-phenylmethoxy-2-(1,1,1-trifluoropropan-2-yl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 71016793) has the molecular formula C24H27F3N2O3S and a molecular weight of 480.55 g/mol. Its IUPAC name is (1'R,4R,10'S)-5'-phenylmethoxy-2-(1,1,1-trifluoropropan-2-yl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | (1'R,4R,10'S)-5'-phenylmethoxy-2-(1,1,1-trifluoropropan-2-yl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 71016793 |
| Molecular Formula | C24H27F3N2O3S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | (1'R,4R,10'S)-5'-phenylmethoxy-2-(1,1,1-trifluoropropan-2-yl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | CC(N1C[C@]2(NS1(=O)=O)[C@@H]1CC[C@H]2Cc2ccc(OCc3ccccc3)cc2C1)C(F)(F)F |
| InChI | InChI=1S/C24H27F3N2O3S/c1-16(24(25,26)27)29-15-23(28-33(29,30)31)20-8-9-21(23)12-19-13-22(10-7-18(19)11-20)32-14-17-5-3-2-4-6-17/h2-7,10,13,16,20-21,28H,8-9,11-12,14-15H2,1H3/t16?,20-,21+,23+/m0/s1 |
| InChIKey | OZHMOKOCKQHEGS-XVNRFORQSA-N |
| XLogP | 4.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |