C20H20O4 — CID 174490789
2-O-tert-butyl 7-O-methyl 9H-fluorene-2,7-dicarboxylate (PubChem CID 174490789) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-O-tert-butyl 7-O-methyl 9H-fluorene-2,7-dicarboxylate.
| Compound Name | 2-O-tert-butyl 7-O-methyl 9H-fluorene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 174490789 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-O-tert-butyl 7-O-methyl 9H-fluorene-2,7-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)Cc1cc(C(=O)OC(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C20H20O4/c1-20(2,3)24-19(22)13-6-8-17-15(10-13)11-14-9-12(18(21)23-4)5-7-16(14)17/h5-10H,11H2,1-4H3 |
| InChIKey | HPCRFSKYCKXFSP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |