methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate

C11H13NO2 — CID 98007137

IUPACmethyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)C[C@H](N)C2
InChIInChI=1S/C11H13NO2/c1-14-11(13)8-3-2-7-5-10(12)6-9(7)4-8/h2-4,10H,5-6,12H2,1H3/t10-/m1/s1
InChIKeySGAIDXAIUTTWQZ-SNVBAGLBSA-N
MW191.23 g/mol
LogP0.90
Rot. Bonds1

About methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate

methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 98007137) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate.

Molecular Properties

Compound Namemethyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate
PubChem CID98007137
Molecular FormulaC11H13NO2
Molecular Weight191.23 g/mol
Exact Mass191.09
IUPAC Namemethyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)C[C@H](N)C2
InChIInChI=1S/C11H13NO2/c1-14-11(13)8-3-2-7-5-10(12)6-9(7)4-8/h2-4,10H,5-6,12H2,1H3/t10-/m1/s1
InChIKeySGAIDXAIUTTWQZ-SNVBAGLBSA-N
XLogP0.90
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate?
The IUPAC name of methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate (CID 98007137) is methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate.
What is the SMILES notation for methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate?
The canonical SMILES for methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate is COC(=O)c1ccc2c(c1)C[C@H](N)C2.
What is the InChIKey of methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate?
The InChIKey is SGAIDXAIUTTWQZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H13NO2/c1-14-11(13)8-3-2-7-5-10(12)6-9(7)4-8/h2-4,10H,5-6,12H2,1H3/t10-/m1/s1.
What are the key properties of methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate?
methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate has a molecular weight of 191.23 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-amino-2,3-dihydro-1H-indene-5-carboxylate is sourced from PubChem (CID 98007137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).