About methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate
methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate (PubChem CID 131598738) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate.
Analyze methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate?
The IUPAC name of methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate (CID 131598738) is methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate.
What is the SMILES notation for methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate?
The canonical SMILES for methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate is COC(=O)c1ccc2c(c1)[C@H](N)COC2.
What is the InChIKey of methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate?
The InChIKey is IKTYCJNCBKWASR-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H13NO3/c1-14-11(13)7-2-3-8-5-15-6-10(12)9(8)4-7/h2-4,10H,5-6,12H2,1H3/t10-/m1/s1.
What are the key properties of methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate?
methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate is sourced from PubChem (CID 131598738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).