C12H15NO3 — CID 131453559
ethyl (4R)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate (PubChem CID 131453559) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl (4R)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate.
| Compound Name | ethyl (4R)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate |
|---|---|
| PubChem CID | 131453559 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | ethyl (4R)-4-amino-3,4-dihydro-1H-isochromene-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)[C@@H](N)COC2 |
| InChI | InChI=1S/C12H15NO3/c1-2-16-12(14)8-3-4-9-6-15-7-11(13)10(9)5-8/h3-5,11H,2,6-7,13H2,1H3/t11-/m0/s1 |
| InChIKey | LCLVJBHNXRVERX-NSHDSACASA-N |
| XLogP | 1.39 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |