C26H20O6 — CID 126722610
trimethyl pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-tricarboxylate (PubChem CID 126722610) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is trimethyl pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-tricarboxylate.
| Compound Name | trimethyl pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-tricarboxylate |
|---|---|
| PubChem CID | 126722610 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | trimethyl pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-tricarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C1c3ccc(C(=O)OC)cc3C2c2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C26H20O6/c1-30-24(27)13-6-9-18-19(10-13)22-16-7-4-14(25(28)31-2)11-20(16)23(18)21-12-15(26(29)32-3)5-8-17(21)22/h4-12,22-23H,1-3H3 |
| InChIKey | CDXGHRIVVRRATQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|