C34H26O8 — CID 44725155
tetramethyl heptacyclo[14.6.2.25,12.02,15.04,13.06,11.017,22]hexacosa-2(15),3,6,8,10,13,17,19,21,23,25-undecaene-23,24,25,26-tetracarboxylate (PubChem CID 44725155) has the molecular formula C34H26O8 and a molecular weight of 562.57 g/mol. Its IUPAC name is tetramethyl heptacyclo[14.6.2.25,12.02,15.04,13.06,11.017,22]hexacosa-2(15),3,6,8,10,13,17,19,21,23,25-undecaene-23,24,25,26-tetracarboxylate.
| Compound Name | tetramethyl heptacyclo[14.6.2.25,12.02,15.04,13.06,11.017,22]hexacosa-2(15),3,6,8,10,13,17,19,21,23,25-undecaene-23,24,25,26-tetracarboxylate |
|---|---|
| PubChem CID | 44725155 |
| Molecular Formula | C34H26O8 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | tetramethyl heptacyclo[14.6.2.25,12.02,15.04,13.06,11.017,22]hexacosa-2(15),3,6,8,10,13,17,19,21,23,25-undecaene-23,24,25,26-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2c3ccccc3C1c1cc3c(cc12)C1C(C(=O)OC)=C(C(=O)OC)C3c2ccccc21 |
| InChI | InChI=1S/C34H26O8/c1-39-31(35)27-23-15-9-5-6-10-16(15)24(28(27)32(36)40-2)20-14-22-21(13-19(20)23)25-17-11-7-8-12-18(17)26(22)30(34(38)42-4)29(25)33(37)41-3/h5-14,23-26H,1-4H3 |
| InChIKey | SQTYUOJGBGEWPH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|