C18H14O2 — CID 13256641
methyl 16-deuteriotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15-carboxylate (PubChem CID 13256641) has the molecular formula C18H14O2 and a molecular weight of 263.31 g/mol. Its IUPAC name is methyl 16-deuteriotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15-carboxylate.
| Compound Name | methyl 16-deuteriotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15-carboxylate |
|---|---|
| PubChem CID | 13256641 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | methyl 16-deuteriotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15-carboxylate |
| SMILES | [2H]C1=C(C(=O)OC)C2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C18H14O2/c1-20-18(19)16-10-15-11-6-2-4-8-13(11)17(16)14-9-5-3-7-12(14)15/h2-10,15,17H,1H3/i10D |
| InChIKey | JUWYWJJNDLGYCT-MMIHMFRQSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |