About dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate
dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 703903) has the molecular formula C16H17NO4
and a molecular weight of 287.32 g/mol. Its IUPAC name is dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| PubChem CID | 703903 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=CNC=C(C(=O)OC)C1c1ccccc1C |
| InChI | InChI=1S/C16H17NO4/c1-10-6-4-5-7-11(10)14-12(15(18)20-2)8-17-9-13(14)16(19)21-3/h4-9,14,17H,1-3H3 |
| InChIKey | KUMPBVLTAFKKSS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate?
The IUPAC name of dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CID 703903) is dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
What is the SMILES notation for dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate?
The canonical SMILES for dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate is COC(=O)C1=CNC=C(C(=O)OC)C1c1ccccc1C.
What is the InChIKey of dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate?
The InChIKey is KUMPBVLTAFKKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4/c1-10-6-4-5-7-11(10)14-12(15(18)20-2)8-17-9-13(14)16(19)21-3/h4-9,14,17H,1-3H3.
What are the key properties of dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate?
dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate has a molecular weight of 287.32 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate is sourced from PubChem (CID 703903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).