C29H25NO4 — CID 16738913
methyl 2-[3,5-dibenzoyl-4-(2-methylphenyl)-4H-pyridin-1-yl]acetate (PubChem CID 16738913) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl 2-[3,5-dibenzoyl-4-(2-methylphenyl)-4H-pyridin-1-yl]acetate.
| Compound Name | methyl 2-[3,5-dibenzoyl-4-(2-methylphenyl)-4H-pyridin-1-yl]acetate |
|---|---|
| PubChem CID | 16738913 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | methyl 2-[3,5-dibenzoyl-4-(2-methylphenyl)-4H-pyridin-1-yl]acetate |
| SMILES | COC(=O)CN1C=C(C(=O)c2ccccc2)C(c2ccccc2C)C(C(=O)c2ccccc2)=C1 |
| InChI | InChI=1S/C29H25NO4/c1-20-11-9-10-16-23(20)27-24(28(32)21-12-5-3-6-13-21)17-30(19-26(31)34-2)18-25(27)29(33)22-14-7-4-8-15-22/h3-18,27H,19H2,1-2H3 |
| InChIKey | YERWETIEZCZGQB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |