C21H24N2O8 — CID 139770410
2-[4-(2-nitrophenyl)-3,5-bis(propoxycarbonyl)-4H-pyridin-1-yl]acetic acid (PubChem CID 139770410) has the molecular formula C21H24N2O8 and a molecular weight of 432.43 g/mol. Its IUPAC name is 2-[4-(2-nitrophenyl)-3,5-bis(propoxycarbonyl)-4H-pyridin-1-yl]acetic acid.
| Compound Name | 2-[4-(2-nitrophenyl)-3,5-bis(propoxycarbonyl)-4H-pyridin-1-yl]acetic acid |
|---|---|
| PubChem CID | 139770410 |
| Molecular Formula | C21H24N2O8 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[4-(2-nitrophenyl)-3,5-bis(propoxycarbonyl)-4H-pyridin-1-yl]acetic acid |
| SMILES | CCCOC(=O)C1=CN(CC(=O)O)C=C(C(=O)OCCC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N2O8/c1-3-9-30-20(26)15-11-22(13-18(24)25)12-16(21(27)31-10-4-2)19(15)14-7-5-6-8-17(14)23(28)29/h5-8,11-12,19H,3-4,9-10,13H2,1-2H3,(H,24,25) |
| InChIKey | SVTQFDVTWNGGBN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|