1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid

C15H14N2O6 — CID 139770407

IUPAC1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid
SMILESCCN1C=C(C(=O)O)C(c2ccccc2[N+](=O)[O-])C(C(=O)O)=C1
InChIInChI=1S/C15H14N2O6/c1-2-16-7-10(14(18)19)13(11(8-16)15(20)21)9-5-3-4-6-12(9)17(22)23/h3-8,13H,2H2,1H3,(H,18,19)(H,20,21)
InChIKeyJDGMPULKVJAPGK-UHFFFAOYSA-N
MW318.29 g/mol
LogP1.95
Rot. Bonds5

About 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid

1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 139770407) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid.

Molecular Properties

Compound Name1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid
PubChem CID139770407
Molecular FormulaC15H14N2O6
Molecular Weight318.29 g/mol
Exact Mass318.09
IUPAC Name1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid
SMILESCCN1C=C(C(=O)O)C(c2ccccc2[N+](=O)[O-])C(C(=O)O)=C1
InChIInChI=1S/C15H14N2O6/c1-2-16-7-10(14(18)19)13(11(8-16)15(20)21)9-5-3-4-6-12(9)17(22)23/h3-8,13H,2H2,1H3,(H,18,19)(H,20,21)
InChIKeyJDGMPULKVJAPGK-UHFFFAOYSA-N
XLogP1.95
TPSA120.98 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.29
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid?
The IUPAC name of 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid (CID 139770407) is 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid is CCN1C=C(C(=O)O)C(c2ccccc2[N+](=O)[O-])C(C(=O)O)=C1.
What is the InChIKey of 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid?
The InChIKey is JDGMPULKVJAPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O6/c1-2-16-7-10(14(18)19)13(11(8-16)15(20)21)9-5-3-4-6-12(9)17(22)23/h3-8,13H,2H2,1H3,(H,18,19)(H,20,21).
What are the key properties of 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid?
1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid has a molecular weight of 318.29 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 139770407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).