C19H16N4O5 — CID 135895902
ethyl (3R,4R)-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 135895902) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is ethyl (3R,4R)-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl (3R,4R)-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 135895902 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | ethyl (3R,4R)-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)Nc2nc3ccccc3n2[C@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O5/c1-2-28-18(25)15-16(11-7-3-5-9-13(11)23(26)27)22-14-10-6-4-8-12(14)20-19(22)21-17(15)24/h3-10,15-16H,2H2,1H3,(H,20,21,24)/t15-,16+/m1/s1 |
| InChIKey | LLEQNLGOFKXHJV-CVEARBPZSA-N |
| XLogP | 2.67 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|