C27H18N2O6 — CID 130229980
2,3-dinitrobenzoic acid;pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene (PubChem CID 130229980) has the molecular formula C27H18N2O6 and a molecular weight of 466.45 g/mol. Its IUPAC name is 2,3-dinitrobenzoic acid;pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene.
| Compound Name | 2,3-dinitrobenzoic acid;pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 130229980 |
| Molecular Formula | C27H18N2O6 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2,3-dinitrobenzoic acid;pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1[N+](=O)[O-].c1ccc2c(c1)C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C20H14.C7H4N2O6/c1-2-8-14-13(7-1)19-15-9-3-5-11-17(15)20(14)18-12-6-4-10-16(18)19;10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15/h1-12,19-20H;1-3H,(H,10,11) |
| InChIKey | SNBSRZFARMZEID-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|