C15H15N3O6 — CID 10958547
3-ethoxycarbonyl-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridazine-5-carboxylic acid (PubChem CID 10958547) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is 3-ethoxycarbonyl-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridazine-5-carboxylic acid.
| Compound Name | 3-ethoxycarbonyl-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridazine-5-carboxylic acid |
|---|---|
| PubChem CID | 10958547 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-ethoxycarbonyl-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridazine-5-carboxylic acid |
| SMILES | CCOC(=O)C1=NNC(C)=C(C(=O)O)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O6/c1-3-24-15(21)13-12(11(14(19)20)8(2)16-17-13)9-6-4-5-7-10(9)18(22)23/h4-7,12,16H,3H2,1-2H3,(H,19,20) |
| InChIKey | ADYCIJAVWZGVQH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|