C19H18N2O8 — CID 91720665
2-O-[(4-methyl-3,5-dinitrophenyl)methyl] 1-O-propyl benzene-1,2-dicarboxylate (PubChem CID 91720665) has the molecular formula C19H18N2O8 and a molecular weight of 402.36 g/mol. Its IUPAC name is 2-O-[(4-methyl-3,5-dinitrophenyl)methyl] 1-O-propyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[(4-methyl-3,5-dinitrophenyl)methyl] 1-O-propyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91720665 |
| Molecular Formula | C19H18N2O8 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-O-[(4-methyl-3,5-dinitrophenyl)methyl] 1-O-propyl benzene-1,2-dicarboxylate |
| SMILES | CCCOC(=O)c1ccccc1C(=O)OCc1cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N2O8/c1-3-8-28-18(22)14-6-4-5-7-15(14)19(23)29-11-13-9-16(20(24)25)12(2)17(10-13)21(26)27/h4-7,9-10H,3,8,11H2,1-2H3 |
| InChIKey | ZUNYYKSSZDXARE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|