C33H27NO2 — CID 16739117
[5-benzoyl-1-benzyl-4-(2-methylphenyl)-4H-pyridin-3-yl]-phenylmethanone (PubChem CID 16739117) has the molecular formula C33H27NO2 and a molecular weight of 469.58 g/mol. Its IUPAC name is [5-benzoyl-1-benzyl-4-(2-methylphenyl)-4H-pyridin-3-yl]-phenylmethanone.
| Compound Name | [5-benzoyl-1-benzyl-4-(2-methylphenyl)-4H-pyridin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 16739117 |
| Molecular Formula | C33H27NO2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | [5-benzoyl-1-benzyl-4-(2-methylphenyl)-4H-pyridin-3-yl]-phenylmethanone |
| SMILES | Cc1ccccc1C1C(C(=O)c2ccccc2)=CN(Cc2ccccc2)C=C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C33H27NO2/c1-24-13-11-12-20-28(24)31-29(32(35)26-16-7-3-8-17-26)22-34(21-25-14-5-2-6-15-25)23-30(31)33(36)27-18-9-4-10-19-27/h2-20,22-23,31H,21H2,1H3 |
| InChIKey | XUKNEMJFWBPSPR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |