C53H42Cl2N2O5 — CID 91382832
bis[4-[5-benzoyl-4-(2-chlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]phenyl]methanone (PubChem CID 91382832) has the molecular formula C53H42Cl2N2O5 and a molecular weight of 857.83 g/mol. Its IUPAC name is bis[4-[5-benzoyl-4-(2-chlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]phenyl]methanone.
| Compound Name | bis[4-[5-benzoyl-4-(2-chlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]phenyl]methanone |
|---|---|
| PubChem CID | 91382832 |
| Molecular Formula | C53H42Cl2N2O5 |
| Molecular Weight | 857.83 g/mol |
| Exact Mass | 856.25 |
| IUPAC Name | bis[4-[5-benzoyl-4-(2-chlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]phenyl]methanone |
| SMILES | O=C(C1=CN(CCO)C=C(c2ccc(C(=O)c3ccc(C4=CN(CCO)C=C(C(=O)c5ccccc5)C4c4ccccc4Cl)cc3)cc2)C1c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C53H42Cl2N2O5/c54-47-17-9-7-15-41(47)49-43(31-56(27-29-58)33-45(49)52(61)37-11-3-1-4-12-37)35-19-23-39(24-20-35)51(60)40-25-21-36(22-26-40)44-32-57(28-30-59)34-46(53(62)38-13-5-2-6-14-38)50(44)42-16-8-10-18-48(42)55/h1-26,31-34,49-50,58-59H,27-30H2 |
| InChIKey | VRRUGZNQFWZADK-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.83 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |