About [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone
[5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone (PubChem CID 16738946) has the molecular formula C27H21Cl2NO3
and a molecular weight of 478.38 g/mol. Its IUPAC name is [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone |
| PubChem CID | 16738946 |
| Molecular Formula | C27H21Cl2NO3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone |
| SMILES | O=C(C1=CN(CCO)C=C(C(=O)c2ccccc2)C1c1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C27H21Cl2NO3/c28-20-11-12-24(29)21(15-20)25-22(26(32)18-7-3-1-4-8-18)16-30(13-14-31)17-23(25)27(33)19-9-5-2-6-10-19/h1-12,15-17,25,31H,13-14H2 |
| InChIKey | NMWCQOMWQFSDQY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone?
The IUPAC name of [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone (CID 16738946) is [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone.
What is the SMILES notation for [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone?
The canonical SMILES for [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone is O=C(C1=CN(CCO)C=C(C(=O)c2ccccc2)C1c1cc(Cl)ccc1Cl)c1ccccc1.
What is the InChIKey of [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone?
The InChIKey is NMWCQOMWQFSDQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21Cl2NO3/c28-20-11-12-24(29)21(15-20)25-22(26(32)18-7-3-1-4-8-18)16-30(13-14-31)17-23(25)27(33)19-9-5-2-6-10-19/h1-12,15-17,25,31H,13-14H2.
What are the key properties of [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone?
[5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone has a molecular weight of 478.38 g/mol, XLogP of 5.92, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-benzoyl-4-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)-4H-pyridin-3-yl]-phenylmethanone is sourced from PubChem (CID 16738946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).